C13H8F4N4O2S — CID 158584691
5-(3-fluoroisoquinolin-6-yl)-1,3,4-thiadiazol-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 158584691) has the molecular formula C13H8F4N4O2S and a molecular weight of 360.29 g/mol. Its IUPAC name is 5-(3-fluoroisoquinolin-6-yl)-1,3,4-thiadiazol-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(3-fluoroisoquinolin-6-yl)-1,3,4-thiadiazol-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158584691 |
| Molecular Formula | C13H8F4N4O2S |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 5-(3-fluoroisoquinolin-6-yl)-1,3,4-thiadiazol-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | Nc1nnc(-c2ccc3cnc(F)cc3c2)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H7FN4S.C2HF3O2/c12-9-4-8-3-6(1-2-7(8)5-14-9)10-15-16-11(13)17-10;3-2(4,5)1(6)7/h1-5H,(H2,13,16);(H,6,7) |
| InChIKey | HTRJWVUERUEHLV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|