About 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane)
2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane) (PubChem CID 158586666) has the molecular formula C24H60O4Si3
and a molecular weight of 497.00 g/mol. Its IUPAC name is 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane).
Molecular Properties
| Compound Name | 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane) |
| PubChem CID | 158586666 |
| Molecular Formula | C24H60O4Si3 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.38 |
| IUPAC Name | 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane) |
| SMILES | CO[Si](C)(C)CC(C)(C)C.CO[Si](C)(C)CC(C)(C)C.CO[Si](C)(CC(C)(C)C)OC |
| InChI | InChI=1S/C8H20O2Si.2C8H20OSi/c1-8(2,3)7-11(6,9-4)10-5;2*1-8(2,3)7-10(5,6)9-4/h7H2,1-6H3;2*7H2,1-6H3 |
| InChIKey | HTXJUVXWWWDWKJ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane)?
The IUPAC name of 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane) (CID 158586666) is 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane).
What is the SMILES notation for 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane)?
The canonical SMILES for 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane) is CO[Si](C)(C)CC(C)(C)C.CO[Si](C)(C)CC(C)(C)C.CO[Si](C)(CC(C)(C)C)OC.
What is the InChIKey of 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane)?
The InChIKey is HTXJUVXWWWDWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20O2Si.2C8H20OSi/c1-8(2,3)7-11(6,9-4)10-5;2*1-8(2,3)7-10(5,6)9-4/h7H2,1-6H3;2*7H2,1-6H3.
What are the key properties of 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane)?
2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane) has a molecular weight of 497.00 g/mol, XLogP of 8.17, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl-dimethoxy-methylsilane;bis(2,2-dimethylpropyl-methoxy-dimethylsilane) is sourced from PubChem (CID 158586666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).