About 3-methyl-5-nitro-1,3-diazinane-2,4-dione
3-methyl-5-nitro-1,3-diazinane-2,4-dione (PubChem CID 15858688) has the molecular formula C5H7N3O4
and a molecular weight of 173.13 g/mol. Its IUPAC name is 3-methyl-5-nitro-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 3-methyl-5-nitro-1,3-diazinane-2,4-dione |
| PubChem CID | 15858688 |
| Molecular Formula | C5H7N3O4 |
| Molecular Weight | 173.13 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | 3-methyl-5-nitro-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)NCC([N+](=O)[O-])C1=O |
| InChI | InChI=1S/C5H7N3O4/c1-7-4(9)3(8(11)12)2-6-5(7)10/h3H,2H2,1H3,(H,6,10) |
| InChIKey | NZCXWXKAHMAIBQ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.13 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-nitro-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-nitro-1,3-diazinane-2,4-dione?
The IUPAC name of 3-methyl-5-nitro-1,3-diazinane-2,4-dione (CID 15858688) is 3-methyl-5-nitro-1,3-diazinane-2,4-dione.
What is the SMILES notation for 3-methyl-5-nitro-1,3-diazinane-2,4-dione?
The canonical SMILES for 3-methyl-5-nitro-1,3-diazinane-2,4-dione is CN1C(=O)NCC([N+](=O)[O-])C1=O.
What is the InChIKey of 3-methyl-5-nitro-1,3-diazinane-2,4-dione?
The InChIKey is NZCXWXKAHMAIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O4/c1-7-4(9)3(8(11)12)2-6-5(7)10/h3H,2H2,1H3,(H,6,10).
What are the key properties of 3-methyl-5-nitro-1,3-diazinane-2,4-dione?
3-methyl-5-nitro-1,3-diazinane-2,4-dione has a molecular weight of 173.13 g/mol, XLogP of -1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-nitro-1,3-diazinane-2,4-dione is sourced from PubChem (CID 15858688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).