C5H7N3O4 — CID 15858688
3-methyl-5-nitro-1,3-diazinane-2,4-dione (PubChem CID 15858688) has the molecular formula C5H7N3O4 and a molecular weight of 173.13 g/mol. Its IUPAC name is 3-methyl-5-nitro-1,3-diazinane-2,4-dione.
| Compound Name | 3-methyl-5-nitro-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 15858688 |
| Molecular Formula | C5H7N3O4 |
| Molecular Weight | 173.13 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | 3-methyl-5-nitro-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)NCC([N+](=O)[O-])C1=O |
| InChI | InChI=1S/C5H7N3O4/c1-7-4(9)3(8(11)12)2-6-5(7)10/h3H,2H2,1H3,(H,6,10) |
| InChIKey | NZCXWXKAHMAIBQ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.13 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|