C16H10N8 — CID 158587422
3,4,5,6,9,10-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),3,5,8(13),9,11,14,16-nonaene;pyrazine (PubChem CID 158587422) has the molecular formula C16H10N8 and a molecular weight of 314.31 g/mol. Its IUPAC name is 3,4,5,6,9,10-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),3,5,8(13),9,11,14,16-nonaene;pyrazine.
| Compound Name | 3,4,5,6,9,10-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),3,5,8(13),9,11,14,16-nonaene;pyrazine |
|---|---|
| PubChem CID | 158587422 |
| Molecular Formula | C16H10N8 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 3,4,5,6,9,10-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),3,5,8(13),9,11,14,16-nonaene;pyrazine |
| SMILES | c1ccc2c(c1)c1ccnnc1c1nnnnc21.c1cnccn1 |
| InChI | InChI=1S/C12H6N6.C4H4N2/c1-2-4-8-7(3-1)9-5-6-13-14-10(9)12-11(8)15-17-18-16-12;1-2-6-4-3-5-1/h1-6H;1-4H |
| InChIKey | HTZRBNWTOFSJAJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|