About 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane
1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 158588187) has the molecular formula C16H36N4
and a molecular weight of 284.49 g/mol. Its IUPAC name is 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 158588187 |
| Molecular Formula | C16H36N4 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CC.CC(C)(C)N1CCNCC1.CN1CC2CC1CN2 |
| InChI | InChI=1S/C8H18N2.C6H12N2.C2H6/c1-8(2,3)10-6-4-9-5-7-10;1-8-4-5-2-6(8)3-7-5;1-2/h9H,4-7H2,1-3H3;5-7H,2-4H2,1H3;1-2H3 |
| InChIKey | HUCDYVMIXGJIPT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane (CID 158588187) is 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane is CC.CC(C)(C)N1CCNCC1.CN1CC2CC1CN2.
What is the InChIKey of 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is HUCDYVMIXGJIPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.C6H12N2.C2H6/c1-8(2,3)10-6-4-9-5-7-10;1-8-4-5-2-6(8)3-7-5;1-2/h9H,4-7H2,1-3H3;5-7H,2-4H2,1H3;1-2H3.
What are the key properties of 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane?
1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 284.49 g/mol, XLogP of 1.38, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylpiperazine;ethane;2-methyl-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 158588187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).