C22H13F7N2O — CID 158588282
(E)-4-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-3-(4-fluorophenyl)but-3-en-2-one (PubChem CID 158588282) has the molecular formula C22H13F7N2O and a molecular weight of 454.35 g/mol. Its IUPAC name is (E)-4-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-3-(4-fluorophenyl)but-3-en-2-one.
| Compound Name | (E)-4-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-3-(4-fluorophenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 158588282 |
| Molecular Formula | C22H13F7N2O |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (E)-4-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-3-(4-fluorophenyl)but-3-en-2-one |
| SMILES | CC(=O)/C(=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H13F7N2O/c1-12(32)19(13-2-4-17(23)5-3-13)11-18-6-7-30-20(31-18)14-8-15(21(24,25)26)10-16(9-14)22(27,28)29/h2-11H,1H3/b19-11- |
| InChIKey | PTYPRNVARSFVLG-ODLFYWEKSA-N |
| XLogP | 6.45 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|