About 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one
2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one (PubChem CID 158590615) has the molecular formula C22H19NO
and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one |
| PubChem CID | 158590615 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one |
| SMILES | CCC#Cc1ccc2c(c1)C1=C(CC(=O)N2)c2cc(C)ccc2C1 |
| InChI | InChI=1S/C22H19NO/c1-3-4-5-15-7-9-21-20(11-15)18-12-16-8-6-14(2)10-17(16)19(18)13-22(24)23-21/h6-11H,3,12-13H2,1-2H3,(H,23,24) |
| InChIKey | VFEQADZMCRUSFX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one?
The IUPAC name of 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one (CID 158590615) is 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one.
What is the SMILES notation for 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one?
The canonical SMILES for 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one is CCC#Cc1ccc2c(c1)C1=C(CC(=O)N2)c2cc(C)ccc2C1.
What is the InChIKey of 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one?
The InChIKey is VFEQADZMCRUSFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO/c1-3-4-5-15-7-9-21-20(11-15)18-12-16-8-6-14(2)10-17(16)19(18)13-22(24)23-21/h6-11H,3,12-13H2,1-2H3,(H,23,24).
What are the key properties of 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one?
2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one has a molecular weight of 313.40 g/mol, XLogP of 4.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-1-ynyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one is sourced from PubChem (CID 158590615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).