C28H30ClN3O3S — CID 158590949
2-[[7-(5-chloro-2-cyclohexyloxy-3-methylphenyl)thieno[3,2-b]pyridin-2-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione (PubChem CID 158590949) has the molecular formula C28H30ClN3O3S and a molecular weight of 524.09 g/mol. Its IUPAC name is 2-[[7-(5-chloro-2-cyclohexyloxy-3-methylphenyl)thieno[3,2-b]pyridin-2-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | 2-[[7-(5-chloro-2-cyclohexyloxy-3-methylphenyl)thieno[3,2-b]pyridin-2-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 158590949 |
| Molecular Formula | C28H30ClN3O3S |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 2-[[7-(5-chloro-2-cyclohexyloxy-3-methylphenyl)thieno[3,2-b]pyridin-2-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
| SMILES | Cc1cc(Cl)cc(-c2ccnc3cc(CN4C(=O)C5CCCCN5C4=O)sc23)c1OC1CCCCC1 |
| InChI | InChI=1S/C28H30ClN3O3S/c1-17-13-18(29)14-22(25(17)35-19-7-3-2-4-8-19)21-10-11-30-23-15-20(36-26(21)23)16-32-27(33)24-9-5-6-12-31(24)28(32)34/h10-11,13-15,19,24H,2-9,12,16H2,1H3 |
| InChIKey | HUKZDDXFCDRNQI-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|