C19H30 — CID 158591556
[(1S,2S)-2,5-di(propan-2-yl)cyclohexyl]methylbenzene (PubChem CID 158591556) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is [(1S,2S)-2,5-di(propan-2-yl)cyclohexyl]methylbenzene.
| Compound Name | [(1S,2S)-2,5-di(propan-2-yl)cyclohexyl]methylbenzene |
|---|---|
| PubChem CID | 158591556 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | [(1S,2S)-2,5-di(propan-2-yl)cyclohexyl]methylbenzene |
| SMILES | CC(C)C1CC[C@@H](C(C)C)[C@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H30/c1-14(2)17-10-11-19(15(3)4)18(13-17)12-16-8-6-5-7-9-16/h5-9,14-15,17-19H,10-13H2,1-4H3/t17?,18-,19+/m1/s1 |
| InChIKey | QGBJXHWKBTWPKJ-CPSIJMPNSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |