C20H19NO — CID 158592287
2-ethyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one (PubChem CID 158592287) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-ethyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one.
| Compound Name | 2-ethyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 158592287 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-ethyl-9-methyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one |
| SMILES | CCc1ccc2c(c1)C1=C(CC(=O)N2)c2cc(C)ccc2C1 |
| InChI | InChI=1S/C20H19NO/c1-3-13-5-7-19-18(9-13)16-10-14-6-4-12(2)8-15(14)17(16)11-20(22)21-19/h4-9H,3,10-11H2,1-2H3,(H,21,22) |
| InChIKey | XNHKPDKEOMOQRH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|