C15H19N2O5- — CID 15859404
(4-nitrophenyl) 2,2,5,5-tetramethyl-1-oxidopyrrolidine-3-carboxylate (PubChem CID 15859404) has the molecular formula C15H19N2O5- and a molecular weight of 307.33 g/mol. Its IUPAC name is (4-nitrophenyl) 2,2,5,5-tetramethyl-1-oxidopyrrolidine-3-carboxylate.
| Compound Name | (4-nitrophenyl) 2,2,5,5-tetramethyl-1-oxidopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 15859404 |
| Molecular Formula | C15H19N2O5- |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (4-nitrophenyl) 2,2,5,5-tetramethyl-1-oxidopyrrolidine-3-carboxylate |
| SMILES | CC1(C)CC(C(=O)Oc2ccc([N+](=O)[O-])cc2)C(C)(C)N1[O-] |
| InChI | InChI=1S/C15H19N2O5/c1-14(2)9-12(15(3,4)17(14)21)13(18)22-11-7-5-10(6-8-11)16(19)20/h5-8,12H,9H2,1-4H3/q-1 |
| InChIKey | KJVBSWJTCSXZGR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|