C30H37NO8 — CID 158594265
(13aS)-7-methoxy-3,6-dimethyl-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine;2-(formyloxymethyl)-2-hydroxybutanedioic acid;methane (PubChem CID 158594265) has the molecular formula C30H37NO8 and a molecular weight of 539.63 g/mol. Its IUPAC name is (13aS)-7-methoxy-3,6-dimethyl-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine;2-(formyloxymethyl)-2-hydroxybutanedioic acid;methane.
| Compound Name | (13aS)-7-methoxy-3,6-dimethyl-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine;2-(formyloxymethyl)-2-hydroxybutanedioic acid;methane |
|---|---|
| PubChem CID | 158594265 |
| Molecular Formula | C30H37NO8 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | (13aS)-7-methoxy-3,6-dimethyl-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine;2-(formyloxymethyl)-2-hydroxybutanedioic acid;methane |
| SMILES | C.COc1cc2c3c(c4ccc(C)cc4c2cc1C)C[C@@H]1CCCN1C3.O=COCC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H25NO.C6H8O7.CH4/c1-14-6-7-17-18(9-14)19-10-15(2)23(25-3)12-21(19)22-13-24-8-4-5-16(24)11-20(17)22;7-3-13-2-6(12,5(10)11)1-4(8)9;/h6-7,9-10,12,16H,4-5,8,11,13H2,1-3H3;3,12H,1-2H2,(H,8,9)(H,10,11);1H4/t16-;;/m0../s1 |
| InChIKey | HUVCSSOARRNERN-SQKCAUCHSA-N |
| XLogP | 4.22 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|