C26H49NO18 — CID 158594514
5-[5-[3,4-dihydroxy-6-methyl-5-[[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]oxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentane-1,2,3,4-tetrol;ethanol (PubChem CID 158594514) has the molecular formula C26H49NO18 and a molecular weight of 663.67 g/mol. Its IUPAC name is 5-[5-[3,4-dihydroxy-6-methyl-5-[[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]oxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentane-1,2,3,4-tetrol;ethanol.
| Compound Name | 5-[5-[3,4-dihydroxy-6-methyl-5-[[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]oxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentane-1,2,3,4-tetrol;ethanol |
|---|---|
| PubChem CID | 158594514 |
| Molecular Formula | C26H49NO18 |
| Molecular Weight | 663.67 g/mol |
| Exact Mass | 663.29 |
| IUPAC Name | 5-[5-[3,4-dihydroxy-6-methyl-5-[[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]oxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentane-1,2,3,4-tetrol;ethanol |
| SMILES | CC1OC(OC2C(CO)OC(OCC(O)C(O)C(O)CO)C(O)C2O)C(O)C(O)C1NC1C=C(CO)C(O)C(O)C1O.CCO |
| InChI | InChI=1S/C24H43NO17.C2H6O/c1-7-13(25-9-2-8(3-26)14(31)18(35)15(9)32)17(34)20(37)24(40-7)42-22-12(5-28)41-23(21(38)19(22)36)39-6-11(30)16(33)10(29)4-27;1-2-3/h2,7,9-38H,3-6H2,1H3;3H,2H2,1H3 |
| InChIKey | HUVXTAPRTVMBMW-UHFFFAOYSA-N |
| XLogP | -8.29 |
| TPSA | 332.17 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.67 |
| LogP ≤ 5 | -8.29 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|