About strontium;5-nitro-1,2,4-triazol-3-one;dinitrate
strontium;5-nitro-1,2,4-triazol-3-one;dinitrate (PubChem CID 158594939) has the molecular formula C2N6O9Sr
and a molecular weight of 339.68 g/mol. Its IUPAC name is strontium;5-nitro-1,2,4-triazol-3-one;dinitrate.
Molecular Properties
| Compound Name | strontium;5-nitro-1,2,4-triazol-3-one;dinitrate |
| PubChem CID | 158594939 |
| Molecular Formula | C2N6O9Sr |
| Molecular Weight | 339.68 g/mol |
| Exact Mass | 339.88 |
| IUPAC Name | strontium;5-nitro-1,2,4-triazol-3-one;dinitrate |
| SMILES | O=C1N=NC([N+](=O)[O-])=N1.O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Sr+2] |
| InChI | InChI=1S/C2N4O3.2NO3.Sr/c7-2-3-1(4-5-2)6(8)9;2*2-1(3)4;/q;2*-1;+2 |
| InChIKey | HUXHVWOOHIPETN-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 229.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.68 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze strontium;5-nitro-1,2,4-triazol-3-one;dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium;5-nitro-1,2,4-triazol-3-one;dinitrate?
The IUPAC name of strontium;5-nitro-1,2,4-triazol-3-one;dinitrate (CID 158594939) is strontium;5-nitro-1,2,4-triazol-3-one;dinitrate.
What is the SMILES notation for strontium;5-nitro-1,2,4-triazol-3-one;dinitrate?
The canonical SMILES for strontium;5-nitro-1,2,4-triazol-3-one;dinitrate is O=C1N=NC([N+](=O)[O-])=N1.O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Sr+2].
What is the InChIKey of strontium;5-nitro-1,2,4-triazol-3-one;dinitrate?
The InChIKey is HUXHVWOOHIPETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2N4O3.2NO3.Sr/c7-2-3-1(4-5-2)6(8)9;2*2-1(3)4;/q;2*-1;+2.
What are the key properties of strontium;5-nitro-1,2,4-triazol-3-one;dinitrate?
strontium;5-nitro-1,2,4-triazol-3-one;dinitrate has a molecular weight of 339.68 g/mol, XLogP of -0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for strontium;5-nitro-1,2,4-triazol-3-one;dinitrate is sourced from PubChem (CID 158594939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).