C38H36F3N3O8 — CID 158594943
benzoic acid;3-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-2-methylbenzoic acid (PubChem CID 158594943) has the molecular formula C38H36F3N3O8 and a molecular weight of 719.71 g/mol. Its IUPAC name is benzoic acid;3-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-2-methylbenzoic acid.
| Compound Name | benzoic acid;3-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-2-methylbenzoic acid |
|---|---|
| PubChem CID | 158594943 |
| Molecular Formula | C38H36F3N3O8 |
| Molecular Weight | 719.71 g/mol |
| Exact Mass | 719.25 |
| IUPAC Name | benzoic acid;3-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-2-methylbenzoic acid |
| SMILES | Cc1c(OC2CCN(CC(O)(c3cn(Cc4ccccc4)c4cc([N+](=O)[O-])ccc34)C(F)(F)F)CC2)cccc1C(=O)O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C31H30F3N3O6.C7H6O2/c1-20-24(29(38)39)8-5-9-28(20)43-23-12-14-35(15-13-23)19-30(40,31(32,33)34)26-18-36(17-21-6-3-2-4-7-21)27-16-22(37(41)42)10-11-25(26)27;8-7(9)6-4-2-1-3-5-6/h2-11,16,18,23,40H,12-15,17,19H2,1H3,(H,38,39);1-5H,(H,8,9) |
| InChIKey | HUXHYJLXCVFLTO-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 155.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.71 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|