C41H54N4O4 — CID 158595291
1-butyl-N-(3-ethynylphenyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide;1-butyl-N-methyl-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide (PubChem CID 158595291) has the molecular formula C41H54N4O4 and a molecular weight of 666.91 g/mol. Its IUPAC name is 1-butyl-N-(3-ethynylphenyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide;1-butyl-N-methyl-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide.
| Compound Name | 1-butyl-N-(3-ethynylphenyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide;1-butyl-N-methyl-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 158595291 |
| Molecular Formula | C41H54N4O4 |
| Molecular Weight | 666.91 g/mol |
| Exact Mass | 666.41 |
| IUPAC Name | 1-butyl-N-(3-ethynylphenyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide;1-butyl-N-methyl-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)c2cc3c(n(CCCC)c2=O)CCCCCC3)c1.CCCCn1c2c(cc(C(=O)NC)c1=O)CCCCCC2 |
| InChI | InChI=1S/C24H28N2O2.C17H26N2O2/c1-3-5-15-26-22-14-9-7-6-8-12-19(22)17-21(24(26)28)23(27)25-20-13-10-11-18(4-2)16-20;1-3-4-11-19-15-10-8-6-5-7-9-13(15)12-14(17(19)21)16(20)18-2/h2,10-11,13,16-17H,3,5-9,12,14-15H2,1H3,(H,25,27);12H,3-11H2,1-2H3,(H,18,20) |
| InChIKey | HUYKZAXGNJFOGD-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.91 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|