C24H34O4S — CID 158595931
1-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-[(2R)-2-methylbutyl]oxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-one (PubChem CID 158595931) has the molecular formula C24H34O4S and a molecular weight of 418.60 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-[(2R)-2-methylbutyl]oxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-one.
| Compound Name | 1-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-[(2R)-2-methylbutyl]oxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-one |
|---|---|
| PubChem CID | 158595931 |
| Molecular Formula | C24H34O4S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-4-methyl-5-[(2R)-2-methylbutyl]oxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-one |
| SMILES | C=C(C)C(=C)C(=O)C[C@@H]1O[C@H](C[C@H](C)CC)[C@H](C)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H34O4S/c1-7-17(4)13-23-19(6)21(15-29(26,27)20-11-9-8-10-12-20)24(28-23)14-22(25)18(5)16(2)3/h8-12,17,19,21,23-24H,2,5,7,13-15H2,1,3-4,6H3/t17-,19-,21-,23-,24+/m1/s1 |
| InChIKey | ATHKKJLVCWWGFY-XXHXRFKQSA-N |
| XLogP | 5.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|