About pyridine;4H-quinolizine
pyridine;4H-quinolizine (PubChem CID 158596877) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is pyridine;4H-quinolizine.
Molecular Properties
| Compound Name | pyridine;4H-quinolizine |
| PubChem CID | 158596877 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | pyridine;4H-quinolizine |
| SMILES | C1=CCN2C=CC=CC2=C1.c1ccncc1 |
| InChI | InChI=1S/C9H9N.C5H5N/c1-3-7-10-8-4-2-6-9(10)5-1;1-2-4-6-5-3-1/h1-7H,8H2;1-5H |
| InChIKey | HVDKSWJHPWCSSC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyridine;4H-quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;4H-quinolizine?
The IUPAC name of pyridine;4H-quinolizine (CID 158596877) is pyridine;4H-quinolizine.
What is the SMILES notation for pyridine;4H-quinolizine?
The canonical SMILES for pyridine;4H-quinolizine is C1=CCN2C=CC=CC2=C1.c1ccncc1.
What is the InChIKey of pyridine;4H-quinolizine?
The InChIKey is HVDKSWJHPWCSSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C5H5N/c1-3-7-10-8-4-2-6-9(10)5-1;1-2-4-6-5-3-1/h1-7H,8H2;1-5H.
What are the key properties of pyridine;4H-quinolizine?
pyridine;4H-quinolizine has a molecular weight of 210.28 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;4H-quinolizine is sourced from PubChem (CID 158596877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).