C36H43FN4O4 — CID 158597361
tert-butyl (1R,3S,4S)-3-[(3R)-3-cyano-4-[4-(1,1'-dimethyl-2-oxospiro[indole-3,3'-piperidine]-5-yl)-2-fluorophenyl]butanoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 158597361) has the molecular formula C36H43FN4O4 and a molecular weight of 614.76 g/mol. Its IUPAC name is tert-butyl (1R,3S,4S)-3-[(3R)-3-cyano-4-[4-(1,1'-dimethyl-2-oxospiro[indole-3,3'-piperidine]-5-yl)-2-fluorophenyl]butanoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,4S)-3-[(3R)-3-cyano-4-[4-(1,1'-dimethyl-2-oxospiro[indole-3,3'-piperidine]-5-yl)-2-fluorophenyl]butanoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 158597361 |
| Molecular Formula | C36H43FN4O4 |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | tert-butyl (1R,3S,4S)-3-[(3R)-3-cyano-4-[4-(1,1'-dimethyl-2-oxospiro[indole-3,3'-piperidine]-5-yl)-2-fluorophenyl]butanoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CN1CCCC2(C1)C(=O)N(C)c1ccc(-c3ccc(C[C@@H](C#N)CC(=O)[C@@H]4[C@H]5CC[C@H](C5)N4C(=O)OC(C)(C)C)c(F)c3)cc12 |
| InChI | InChI=1S/C36H43FN4O4/c1-35(2,3)45-34(44)41-27-11-9-26(17-27)32(41)31(42)16-22(20-38)15-25-8-7-24(19-29(25)37)23-10-12-30-28(18-23)36(33(43)40(30)5)13-6-14-39(4)21-36/h7-8,10,12,18-19,22,26-27,32H,6,9,11,13-17,21H2,1-5H3/t22-,26+,27-,32+,36?/m1/s1 |
| InChIKey | HVEVYCHYXOEVMB-OEDOZKBUSA-N |
| XLogP | 5.86 |
| TPSA | 93.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |