About 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole)
2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole) (PubChem CID 158597391) has the molecular formula C29H56N10
and a molecular weight of 544.84 g/mol. Its IUPAC name is 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole).
Molecular Properties
| Compound Name | 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole) |
| PubChem CID | 158597391 |
| Molecular Formula | C29H56N10 |
| Molecular Weight | 544.84 g/mol |
| Exact Mass | 544.47 |
| IUPAC Name | 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole) |
| SMILES | CC(C)(C)c1cn(C(C)(C)C)nn1.CC(C)(C)c1cn(C(C)(C)C)nn1.CC(C)(C)c1nnn(C(C)(C)C)n1 |
| InChI | InChI=1S/2C10H19N3.C9H18N4/c2*1-9(2,3)8-7-13(12-11-8)10(4,5)6;1-8(2,3)7-10-12-13(11-7)9(4,5)6/h2*7H,1-6H3;1-6H3 |
| InChIKey | HVEYQJCZYVKMBH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 105.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.84 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole)?
The IUPAC name of 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole) (CID 158597391) is 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole).
What is the SMILES notation for 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole)?
The canonical SMILES for 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole) is CC(C)(C)c1cn(C(C)(C)C)nn1.CC(C)(C)c1cn(C(C)(C)C)nn1.CC(C)(C)c1nnn(C(C)(C)C)n1.
What is the InChIKey of 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole)?
The InChIKey is HVEYQJCZYVKMBH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H19N3.C9H18N4/c2*1-9(2,3)8-7-13(12-11-8)10(4,5)6;1-8(2,3)7-10-12-13(11-7)9(4,5)6/h2*7H,1-6H3;1-6H3.
What are the key properties of 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole)?
2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole) has a molecular weight of 544.84 g/mol, XLogP of 6.39, 0 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyltetrazole;bis(1,4-ditert-butyltriazole) is sourced from PubChem (CID 158597391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).