C19H16ClFN4O2 — CID 158597737
acetamide;9-(4-chlorophenyl)-11-fluoro-3-methyl-5-oxa-4,8,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaene (PubChem CID 158597737) has the molecular formula C19H16ClFN4O2 and a molecular weight of 386.81 g/mol. Its IUPAC name is acetamide;9-(4-chlorophenyl)-11-fluoro-3-methyl-5-oxa-4,8,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaene.
| Compound Name | acetamide;9-(4-chlorophenyl)-11-fluoro-3-methyl-5-oxa-4,8,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaene |
|---|---|
| PubChem CID | 158597737 |
| Molecular Formula | C19H16ClFN4O2 |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | acetamide;9-(4-chlorophenyl)-11-fluoro-3-methyl-5-oxa-4,8,12-triazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,8,11,13-hexaene |
| SMILES | CC(N)=O.Cc1noc2c1-c1ccnc(F)c1C(c1ccc(Cl)cc1)=NC2 |
| InChI | InChI=1S/C17H11ClFN3O.C2H5NO/c1-9-14-12-6-7-20-17(19)15(12)16(21-8-13(14)23-22-9)10-2-4-11(18)5-3-10;1-2(3)4/h2-7H,8H2,1H3;1H3,(H2,3,4) |
| InChIKey | HVFZQUDIUFFUMF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|