C44H40ClFN2O4 — CID 158599165
3-[4-(3-chlorophenoxy)phenyl]-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one;3-[4-(3-fluorophenoxy)phenyl]-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one (PubChem CID 158599165) has the molecular formula C44H40ClFN2O4 and a molecular weight of 715.27 g/mol. Its IUPAC name is 3-[4-(3-chlorophenoxy)phenyl]-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one;3-[4-(3-fluorophenoxy)phenyl]-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one.
| Compound Name | 3-[4-(3-chlorophenoxy)phenyl]-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one;3-[4-(3-fluorophenoxy)phenyl]-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 158599165 |
| Molecular Formula | C44H40ClFN2O4 |
| Molecular Weight | 715.27 g/mol |
| Exact Mass | 714.27 |
| IUPAC Name | 3-[4-(3-chlorophenoxy)phenyl]-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one;3-[4-(3-fluorophenoxy)phenyl]-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2c(c(=O)c1-c1ccc(Oc3cccc(Cl)c3)cc1)CCCC2.Cc1[nH]c2c(c(=O)c1-c1ccc(Oc3cccc(F)c3)cc1)CCCC2 |
| InChI | InChI=1S/C22H20ClNO2.C22H20FNO2/c2*1-14-21(22(25)19-7-2-3-8-20(19)24-14)15-9-11-17(12-10-15)26-18-6-4-5-16(23)13-18/h2*4-6,9-13H,2-3,7-8H2,1H3,(H,24,25) |
| InChIKey | HVKJUOCMNSIUEK-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.27 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |