C32H28BrN3O2 — CID 158601564
N-(5-bromo-2-methylphenyl)benzamide;N-(2-methyl-5-pyrrol-1-ylphenyl)benzamide (PubChem CID 158601564) has the molecular formula C32H28BrN3O2 and a molecular weight of 566.50 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)benzamide;N-(2-methyl-5-pyrrol-1-ylphenyl)benzamide.
| Compound Name | N-(5-bromo-2-methylphenyl)benzamide;N-(2-methyl-5-pyrrol-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 158601564 |
| Molecular Formula | C32H28BrN3O2 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)benzamide;N-(2-methyl-5-pyrrol-1-ylphenyl)benzamide |
| SMILES | Cc1ccc(-n2cccc2)cc1NC(=O)c1ccccc1.Cc1ccc(Br)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O.C14H12BrNO/c1-14-9-10-16(20-11-5-6-12-20)13-17(14)19-18(21)15-7-3-2-4-8-15;1-10-7-8-12(15)9-13(10)16-14(17)11-5-3-2-4-6-11/h2-13H,1H3,(H,19,21);2-9H,1H3,(H,16,17) |
| InChIKey | HVRUPQPIRDHOEX-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |