C43H38F4N10 — CID 158601643
bis(N-[[3-fluoro-1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]-6-(3-isocyanophenyl)pyridazin-3-amine);methane (PubChem CID 158601643) has the molecular formula C43H38F4N10 and a molecular weight of 770.84 g/mol. Its IUPAC name is bis(N-[[3-fluoro-1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]-6-(3-isocyanophenyl)pyridazin-3-amine);methane.
| Compound Name | bis(N-[[3-fluoro-1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]-6-(3-isocyanophenyl)pyridazin-3-amine);methane |
|---|---|
| PubChem CID | 158601643 |
| Molecular Formula | C43H38F4N10 |
| Molecular Weight | 770.84 g/mol |
| Exact Mass | 770.32 |
| IUPAC Name | bis(N-[[3-fluoro-1-(3-fluoro-2-pyridinyl)cyclobutyl]methyl]-6-(3-isocyanophenyl)pyridazin-3-amine);methane |
| SMILES | C.[C-]#[N+]c1cccc(-c2ccc(NCC3(c4ncccc4F)CC(F)C3)nn2)c1.[C-]#[N+]c1cccc(-c2ccc(NCC3(c4ncccc4F)CC(F)C3)nn2)c1 |
| InChI | InChI=1S/2C21H17F2N5.CH4/c2*1-24-16-5-2-4-14(10-16)18-7-8-19(28-27-18)26-13-21(11-15(22)12-21)20-17(23)6-3-9-25-20;/h2*2-10,15H,11-13H2,(H,26,28);1H4 |
| InChIKey | HVSAVDCOSOXPCD-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 110.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.84 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|