C18H16F2N4O3 — CID 158601658
5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine;oxaldehydic acid (PubChem CID 158601658) has the molecular formula C18H16F2N4O3 and a molecular weight of 374.35 g/mol. Its IUPAC name is 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine;oxaldehydic acid.
| Compound Name | 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine;oxaldehydic acid |
|---|---|
| PubChem CID | 158601658 |
| Molecular Formula | C18H16F2N4O3 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine;oxaldehydic acid |
| SMILES | Fc1ccc(F)c(C2CCCN2c2ccn3nccc3n2)c1.O=CC(=O)O |
| InChI | InChI=1S/C16H14F2N4.C2H2O3/c17-11-3-4-13(18)12(10-11)14-2-1-8-21(14)15-6-9-22-16(20-15)5-7-19-22;3-1-2(4)5/h3-7,9-10,14H,1-2,8H2;1H,(H,4,5) |
| InChIKey | HVSBOKYXHPGQHH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|