C26H32N2O4S2 — CID 15860184
ethyl 11-(diethylaminomethyl)-13-(3,4-dimethoxyphenyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate (PubChem CID 15860184) has the molecular formula C26H32N2O4S2 and a molecular weight of 500.69 g/mol. Its IUPAC name is ethyl 11-(diethylaminomethyl)-13-(3,4-dimethoxyphenyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate.
| Compound Name | ethyl 11-(diethylaminomethyl)-13-(3,4-dimethoxyphenyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 15860184 |
| Molecular Formula | C26H32N2O4S2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | ethyl 11-(diethylaminomethyl)-13-(3,4-dimethoxyphenyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate |
| SMILES | CCOC(=O)c1c(CN(CC)CC)nc2sc3c(c2c1-c1ccc(OC)c(OC)c1)CCSC3 |
| InChI | InChI=1S/C26H32N2O4S2/c1-6-28(7-2)14-18-24(26(29)32-8-3)22(16-9-10-19(30-4)20(13-16)31-5)23-17-11-12-33-15-21(17)34-25(23)27-18/h9-10,13H,6-8,11-12,14-15H2,1-5H3 |
| InChIKey | VFZNBHDCRUNXBQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |