C24H24N4O4S2 — CID 15860185
ethyl 13-(3,4-dimethoxyphenyl)-11-(1,2,4-triazol-1-ylmethyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate (PubChem CID 15860185) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is ethyl 13-(3,4-dimethoxyphenyl)-11-(1,2,4-triazol-1-ylmethyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate.
| Compound Name | ethyl 13-(3,4-dimethoxyphenyl)-11-(1,2,4-triazol-1-ylmethyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 15860185 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | ethyl 13-(3,4-dimethoxyphenyl)-11-(1,2,4-triazol-1-ylmethyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate |
| SMILES | CCOC(=O)c1c(Cn2cncn2)nc2sc3c(c2c1-c1ccc(OC)c(OC)c1)CCSC3 |
| InChI | InChI=1S/C24H24N4O4S2/c1-4-32-24(29)22-16(10-28-13-25-12-26-28)27-23-21(15-7-8-33-11-19(15)34-23)20(22)14-5-6-17(30-2)18(9-14)31-3/h5-6,9,12-13H,4,7-8,10-11H2,1-3H3 |
| InChIKey | YZNMTCJFZJDBIW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |