About 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile
2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile (PubChem CID 158602010) has the molecular formula C31H27NO2
and a molecular weight of 445.56 g/mol. Its IUPAC name is 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile.
Molecular Properties
| Compound Name | 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile |
| PubChem CID | 158602010 |
| Molecular Formula | C31H27NO2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile |
| SMILES | N#CCCC(C=O)(c1ccccc1)c1ccccc1.O=CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15NO.C14H12O/c18-13-7-12-17(14-19,15-8-3-1-4-9-15)16-10-5-2-6-11-16;15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-6,8-11,14H,7,12H2;1-11,14H |
| InChIKey | HVTCRRKOCLVLDA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile?
The IUPAC name of 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile (CID 158602010) is 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile.
What is the SMILES notation for 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile?
The canonical SMILES for 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile is N#CCCC(C=O)(c1ccccc1)c1ccccc1.O=CC(c1ccccc1)c1ccccc1.
What is the InChIKey of 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile?
The InChIKey is HVTCRRKOCLVLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO.C14H12O/c18-13-7-12-17(14-19,15-8-3-1-4-9-15)16-10-5-2-6-11-16;15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-6,8-11,14H,7,12H2;1-11,14H.
What are the key properties of 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile?
2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile has a molecular weight of 445.56 g/mol, XLogP of 6.49, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diphenylacetaldehyde;5-oxo-4,4-diphenylpentanenitrile is sourced from PubChem (CID 158602010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).