C24H27N5O4S — CID 158602859
N-(3-methylsulfonylpropyl)-4-[(1-oxo-2,3-dihydroinden-4-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 158602859) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is N-(3-methylsulfonylpropyl)-4-[(1-oxo-2,3-dihydroinden-4-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | N-(3-methylsulfonylpropyl)-4-[(1-oxo-2,3-dihydroinden-4-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 158602859 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-(3-methylsulfonylpropyl)-4-[(1-oxo-2,3-dihydroinden-4-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)C1CCc2[nH]c3ncnc(Nc4cccc5c4CCC5=O)c3c2C1 |
| InChI | InChI=1S/C24H27N5O4S/c1-34(32,33)11-3-10-25-24(31)14-6-8-19-17(12-14)21-22(26-13-27-23(21)29-19)28-18-5-2-4-16-15(18)7-9-20(16)30/h2,4-5,13-14H,3,6-12H2,1H3,(H,25,31)(H2,26,27,28,29) |
| InChIKey | JZRHTDDKUSPARR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|