C14H27FN2O — CID 158604250
N-tert-butyl-1-[(3R,4R)-3-fluorooxan-4-yl]piperidin-4-amine (PubChem CID 158604250) has the molecular formula C14H27FN2O and a molecular weight of 258.38 g/mol. Its IUPAC name is N-tert-butyl-1-[(3R,4R)-3-fluorooxan-4-yl]piperidin-4-amine.
| Compound Name | N-tert-butyl-1-[(3R,4R)-3-fluorooxan-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 158604250 |
| Molecular Formula | C14H27FN2O |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N-tert-butyl-1-[(3R,4R)-3-fluorooxan-4-yl]piperidin-4-amine |
| SMILES | CC(C)(C)NC1CCN([C@@H]2CCOC[C@@H]2F)CC1 |
| InChI | InChI=1S/C14H27FN2O/c1-14(2,3)16-11-4-7-17(8-5-11)13-6-9-18-10-12(13)15/h11-13,16H,4-10H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | PPGDYFIPAXVYHU-QWHCGFSZSA-N |
| XLogP | 1.97 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |