About N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine
N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine (PubChem CID 158604866) has the molecular formula C9H13Cl3N2O
and a molecular weight of 271.57 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine.
Molecular Properties
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine |
| PubChem CID | 158604866 |
| Molecular Formula | C9H13Cl3N2O |
| Molecular Weight | 271.57 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine |
| SMILES | ClC(Cl)(Cl)C=NOC1CN2CCC1CC2 |
| InChI | InChI=1S/C9H13Cl3N2O/c10-9(11,12)6-13-15-8-5-14-3-1-7(8)2-4-14/h6-8H,1-5H2 |
| InChIKey | HWCAFNFDYUBEKB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine?
The IUPAC name of N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine (CID 158604866) is N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine.
What is the SMILES notation for N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine?
The canonical SMILES for N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine is ClC(Cl)(Cl)C=NOC1CN2CCC1CC2.
What is the InChIKey of N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine?
The InChIKey is HWCAFNFDYUBEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Cl3N2O/c10-9(11,12)6-13-15-8-5-14-3-1-7(8)2-4-14/h6-8H,1-5H2.
What are the key properties of N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine?
N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine has a molecular weight of 271.57 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-azabicyclo[2.2.2]octan-3-yloxy)-2,2,2-trichloroethanimine is sourced from PubChem (CID 158604866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).