C26H30S2Si3 — CID 15860531
(7,7-diphenyl-10-trimethylsilyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-trimethylsilane (PubChem CID 15860531) has the molecular formula C26H30S2Si3 and a molecular weight of 490.92 g/mol. Its IUPAC name is (7,7-diphenyl-10-trimethylsilyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-trimethylsilane.
| Compound Name | (7,7-diphenyl-10-trimethylsilyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-trimethylsilane |
|---|---|
| PubChem CID | 15860531 |
| Molecular Formula | C26H30S2Si3 |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | (7,7-diphenyl-10-trimethylsilyl-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc2c(s1)-c1sc([Si](C)(C)C)cc1[Si]2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30S2Si3/c1-29(2,3)23-17-21-25(27-23)26-22(18-24(28-26)30(4,5)6)31(21,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-18H,1-6H3 |
| InChIKey | XWDOQFMZZAOVDR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|