C13H10F5NO6S — CID 158606846
3-(3,5-difluorophenyl)-5-[1-(trifluoromethylsulfonyloxy)ethyl]-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 158606846) has the molecular formula C13H10F5NO6S and a molecular weight of 403.28 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-5-[1-(trifluoromethylsulfonyloxy)ethyl]-4H-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(3,5-difluorophenyl)-5-[1-(trifluoromethylsulfonyloxy)ethyl]-4H-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 158606846 |
| Molecular Formula | C13H10F5NO6S |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 3-(3,5-difluorophenyl)-5-[1-(trifluoromethylsulfonyloxy)ethyl]-4H-1,2-oxazole-5-carboxylic acid |
| SMILES | CC(OS(=O)(=O)C(F)(F)F)C1(C(=O)O)CC(c2cc(F)cc(F)c2)=NO1 |
| InChI | InChI=1S/C13H10F5NO6S/c1-6(24-26(22,23)13(16,17)18)12(11(20)21)5-10(19-25-12)7-2-8(14)4-9(15)3-7/h2-4,6H,5H2,1H3,(H,20,21) |
| InChIKey | HWIHNQWRBDPDFV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|