About 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile
4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile (PubChem CID 15860713) has the molecular formula C35H34N2O5
and a molecular weight of 562.67 g/mol. Its IUPAC name is 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile |
| PubChem CID | 15860713 |
| Molecular Formula | C35H34N2O5 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(OCCOCCOCCOCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1C#N |
| InChI | InChI=1S/C35H34N2O5/c36-27-29-16-17-34(26-30(29)28-37)41-24-22-39-20-18-38-19-21-40-23-25-42-35(31-10-4-1-5-11-31,32-12-6-2-7-13-32)33-14-8-3-9-15-33/h1-17,26H,18-25H2 |
| InChIKey | NCLKMJITHLEVQT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 93.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile?
The IUPAC name of 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile (CID 15860713) is 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile is N#Cc1ccc(OCCOCCOCCOCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1C#N.
What is the InChIKey of 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile?
The InChIKey is NCLKMJITHLEVQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H34N2O5/c36-27-29-16-17-34(26-30(29)28-37)41-24-22-39-20-18-38-19-21-40-23-25-42-35(31-10-4-1-5-11-31,32-12-6-2-7-13-32)33-14-8-3-9-15-33/h1-17,26H,18-25H2.
What are the key properties of 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile?
4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile has a molecular weight of 562.67 g/mol, XLogP of 5.87, 17 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethoxy]benzene-1,2-dicarbonitrile is sourced from PubChem (CID 15860713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).