About N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide
N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide (PubChem CID 158607990) has the molecular formula C12H18F3NO
and a molecular weight of 249.28 g/mol. Its IUPAC name is N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide |
| PubChem CID | 158607990 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide |
| SMILES | CC(=O)NC1C=C(C(F)(F)F)CC(C)[C@H](C)C1 |
| InChI | InChI=1S/C12H18F3NO/c1-7-4-10(12(13,14)15)6-11(5-8(7)2)16-9(3)17/h6-8,11H,4-5H2,1-3H3,(H,16,17)/t7?,8-,11?/m1/s1 |
| InChIKey | HWLYTJSKISVAQC-JKDSDDBFSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide?
The IUPAC name of N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide (CID 158607990) is N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide.
What is the SMILES notation for N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide?
The canonical SMILES for N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide is CC(=O)NC1C=C(C(F)(F)F)CC(C)[C@H](C)C1.
What is the InChIKey of N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide?
The InChIKey is HWLYTJSKISVAQC-JKDSDDBFSA-N. The full InChI is InChI=1S/C12H18F3NO/c1-7-4-10(12(13,14)15)6-11(5-8(7)2)16-9(3)17/h6-8,11H,4-5H2,1-3H3,(H,16,17)/t7?,8-,11?/m1/s1.
What are the key properties of N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide?
N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide has a molecular weight of 249.28 g/mol, XLogP of 3.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6R)-5,6-dimethyl-3-(trifluoromethyl)cyclohept-2-en-1-yl]acetamide is sourced from PubChem (CID 158607990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).