About methane;urea;hydrate
methane;urea;hydrate (PubChem CID 158608154) has the molecular formula C5H22N2O2
and a molecular weight of 142.24 g/mol. Its IUPAC name is methane;urea;hydrate.
Molecular Properties
| Compound Name | methane;urea;hydrate |
| PubChem CID | 158608154 |
| Molecular Formula | C5H22N2O2 |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.17 |
| IUPAC Name | methane;urea;hydrate |
| SMILES | C.C.C.C.NC(N)=O.O |
| InChI | InChI=1S/CH4N2O.4CH4.H2O/c2-1(3)4;;;;;/h(H4,2,3,4);4*1H4;1H2 |
| InChIKey | ZPYHQQFDNCGLRD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;urea;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;urea;hydrate?
The IUPAC name of methane;urea;hydrate (CID 158608154) is methane;urea;hydrate.
What is the SMILES notation for methane;urea;hydrate?
The canonical SMILES for methane;urea;hydrate is C.C.C.C.NC(N)=O.O.
What is the InChIKey of methane;urea;hydrate?
The InChIKey is ZPYHQQFDNCGLRD-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.4CH4.H2O/c2-1(3)4;;;;;/h(H4,2,3,4);4*1H4;1H2.
What are the key properties of methane;urea;hydrate?
methane;urea;hydrate has a molecular weight of 142.24 g/mol, XLogP of 0.74, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;urea;hydrate is sourced from PubChem (CID 158608154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).