C24H33FO4S2 — CID 158610582
2-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-[3-(2,2-dimethylpropoxy)propylsulfonyl]ethyl]thiophene (PubChem CID 158610582) has the molecular formula C24H33FO4S2 and a molecular weight of 468.66 g/mol. Its IUPAC name is 2-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-[3-(2,2-dimethylpropoxy)propylsulfonyl]ethyl]thiophene.
| Compound Name | 2-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-[3-(2,2-dimethylpropoxy)propylsulfonyl]ethyl]thiophene |
|---|---|
| PubChem CID | 158610582 |
| Molecular Formula | C24H33FO4S2 |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-[3-(2,2-dimethylpropoxy)propylsulfonyl]ethyl]thiophene |
| SMILES | CC(C)(C)COCCCS(=O)(=O)C[C@@H](c1ccc(F)c(OCC2CC2)c1)c1cccs1 |
| InChI | InChI=1S/C24H33FO4S2/c1-24(2,3)17-28-11-5-13-31(26,27)16-20(23-6-4-12-30-23)19-9-10-21(25)22(14-19)29-15-18-7-8-18/h4,6,9-10,12,14,18,20H,5,7-8,11,13,15-17H2,1-3H3/t20-/m0/s1 |
| InChIKey | YMBGUXGRUKGMJK-FQEVSTJZSA-N |
| XLogP | 5.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|