About 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene
2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene (PubChem CID 158611419) has the molecular formula C33H48
and a molecular weight of 444.75 g/mol. Its IUPAC name is 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene |
| PubChem CID | 158611419 |
| Molecular Formula | C33H48 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene |
| SMILES | CC(C)(C)c1ccc2cccc(C(C)(C)C)c2c1.Cc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C18H24.C15H24/c1-17(2,3)14-11-10-13-8-7-9-16(15(13)12-14)18(4,5)6;1-11-8-9-12(14(2,3)4)10-13(11)15(5,6)7/h7-12H,1-6H3;8-10H,1-7H3 |
| InChIKey | HWWPSWQXKMRUJF-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene?
The IUPAC name of 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene (CID 158611419) is 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene.
What is the SMILES notation for 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene?
The canonical SMILES for 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene is CC(C)(C)c1ccc2cccc(C(C)(C)C)c2c1.Cc1ccc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene?
The InChIKey is HWWPSWQXKMRUJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24.C15H24/c1-17(2,3)14-11-10-13-8-7-9-16(15(13)12-14)18(4,5)6;1-11-8-9-12(14(2,3)4)10-13(11)15(5,6)7/h7-12H,1-6H3;8-10H,1-7H3.
What are the key properties of 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene?
2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene has a molecular weight of 444.75 g/mol, XLogP of 10.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-1-methylbenzene;1,7-ditert-butylnaphthalene is sourced from PubChem (CID 158611419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).