About pentafluoro-λ5-phosphane;trifluoroborane
pentafluoro-λ5-phosphane;trifluoroborane (PubChem CID 158611700) has the molecular formula BF8P
and a molecular weight of 193.77 g/mol. Its IUPAC name is pentafluoro-λ5-phosphane;trifluoroborane.
Molecular Properties
| Compound Name | pentafluoro-λ5-phosphane;trifluoroborane |
| PubChem CID | 158611700 |
| Molecular Formula | BF8P |
| Molecular Weight | 193.77 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | pentafluoro-λ5-phosphane;trifluoroborane |
| SMILES | FB(F)F.FP(F)(F)(F)F |
| InChI | InChI=1S/BF3.F5P/c2-1(3)4;1-6(2,3,4)5 |
| InChIKey | HWXKOMYPIRMCKX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.77 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentafluoro-λ5-phosphane;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentafluoro-λ5-phosphane;trifluoroborane?
The IUPAC name of pentafluoro-λ5-phosphane;trifluoroborane (CID 158611700) is pentafluoro-λ5-phosphane;trifluoroborane.
What is the SMILES notation for pentafluoro-λ5-phosphane;trifluoroborane?
The canonical SMILES for pentafluoro-λ5-phosphane;trifluoroborane is FB(F)F.FP(F)(F)(F)F.
What is the InChIKey of pentafluoro-λ5-phosphane;trifluoroborane?
The InChIKey is HWXKOMYPIRMCKX-UHFFFAOYSA-N. The full InChI is InChI=1S/BF3.F5P/c2-1(3)4;1-6(2,3,4)5.
What are the key properties of pentafluoro-λ5-phosphane;trifluoroborane?
pentafluoro-λ5-phosphane;trifluoroborane has a molecular weight of 193.77 g/mol, XLogP of 3.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentafluoro-λ5-phosphane;trifluoroborane is sourced from PubChem (CID 158611700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).