C46H43BN4Si2 — CID 158611777
[8,14-bis(2-pyridin-2-ylphenyl)-18-trimethylsilyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]-trimethylsilane (PubChem CID 158611777) has the molecular formula C46H43BN4Si2 and a molecular weight of 718.86 g/mol. Its IUPAC name is [8,14-bis(2-pyridin-2-ylphenyl)-18-trimethylsilyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]-trimethylsilane.
| Compound Name | [8,14-bis(2-pyridin-2-ylphenyl)-18-trimethylsilyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 158611777 |
| Molecular Formula | C46H43BN4Si2 |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | [8,14-bis(2-pyridin-2-ylphenyl)-18-trimethylsilyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc2c(c1)B1c3cc([Si](C)(C)C)ccc3N(c3ccccc3-c3ccccn3)c3cccc(c31)N2c1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C46H43BN4Si2/c1-52(2,3)32-24-26-42-36(30-32)47-37-31-33(53(4,5)6)25-27-43(37)51(41-21-10-8-17-35(41)39-19-12-14-29-49-39)45-23-15-22-44(46(45)47)50(42)40-20-9-7-16-34(40)38-18-11-13-28-48-38/h7-31H,1-6H3 |
| InChIKey | ZXKYOUMCXVFDRU-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|