C10H19NS — CID 158612051
5-methylidene-8-propan-2-yl-1,4-thiazocane (PubChem CID 158612051) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is 5-methylidene-8-propan-2-yl-1,4-thiazocane.
| Compound Name | 5-methylidene-8-propan-2-yl-1,4-thiazocane |
|---|---|
| PubChem CID | 158612051 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5-methylidene-8-propan-2-yl-1,4-thiazocane |
| SMILES | C=C1CCC(C(C)C)SCCN1 |
| InChI | InChI=1S/C10H19NS/c1-8(2)10-5-4-9(3)11-6-7-12-10/h8,10-11H,3-7H2,1-2H3 |
| InChIKey | YVGGYFAYTGNYLI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |