C38H31Cl3N8 — CID 158613377
6-chloro-N-[3-(indol-1-ylmethyl)phenyl]pyrimidin-4-amine;4,6-dichloropyrimidine;3-(indol-1-ylmethyl)aniline (PubChem CID 158613377) has the molecular formula C38H31Cl3N8 and a molecular weight of 706.08 g/mol. Its IUPAC name is 6-chloro-N-[3-(indol-1-ylmethyl)phenyl]pyrimidin-4-amine;4,6-dichloropyrimidine;3-(indol-1-ylmethyl)aniline.
| Compound Name | 6-chloro-N-[3-(indol-1-ylmethyl)phenyl]pyrimidin-4-amine;4,6-dichloropyrimidine;3-(indol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 158613377 |
| Molecular Formula | C38H31Cl3N8 |
| Molecular Weight | 706.08 g/mol |
| Exact Mass | 704.17 |
| IUPAC Name | 6-chloro-N-[3-(indol-1-ylmethyl)phenyl]pyrimidin-4-amine;4,6-dichloropyrimidine;3-(indol-1-ylmethyl)aniline |
| SMILES | Clc1cc(Cl)ncn1.Clc1cc(Nc2cccc(Cn3ccc4ccccc43)c2)ncn1.Nc1cccc(Cn2ccc3ccccc32)c1 |
| InChI | InChI=1S/C19H15ClN4.C15H14N2.C4H2Cl2N2/c20-18-11-19(22-13-21-18)23-16-6-3-4-14(10-16)12-24-9-8-15-5-1-2-7-17(15)24;16-14-6-3-4-12(10-14)11-17-9-8-13-5-1-2-7-15(13)17;5-3-1-4(6)8-2-7-3/h1-11,13H,12H2,(H,21,22,23);1-10H,11,16H2;1-2H |
| InChIKey | HXCKXEMETFUANZ-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.08 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|