C25H28Cl2N2O — CID 158613502
1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol (PubChem CID 158613502) has the molecular formula C25H28Cl2N2O and a molecular weight of 443.42 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol |
|---|---|
| PubChem CID | 158613502 |
| Molecular Formula | C25H28Cl2N2O |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol |
| SMILES | Nc1c(Cl)cc(C(O)CN(CCCc2ccccc2)CCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C25H28Cl2N2O/c26-22-16-21(17-23(27)25(22)28)24(30)18-29(15-13-20-10-5-2-6-11-20)14-7-12-19-8-3-1-4-9-19/h1-6,8-11,16-17,24,30H,7,12-15,18,28H2 |
| InChIKey | XFUDQSBKBXSWER-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|