About 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol
1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol (PubChem CID 158613502) has the molecular formula C25H28Cl2N2O
and a molecular weight of 443.42 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol.
Molecular Properties
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol |
| PubChem CID | 158613502 |
| Molecular Formula | C25H28Cl2N2O |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol |
| SMILES | Nc1c(Cl)cc(C(O)CN(CCCc2ccccc2)CCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C25H28Cl2N2O/c26-22-16-21(17-23(27)25(22)28)24(30)18-29(15-13-20-10-5-2-6-11-20)14-7-12-19-8-3-1-4-9-19/h1-6,8-11,16-17,24,30H,7,12-15,18,28H2 |
| InChIKey | XFUDQSBKBXSWER-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol?
The IUPAC name of 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol (CID 158613502) is 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol.
What is the SMILES notation for 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol?
The canonical SMILES for 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol is Nc1c(Cl)cc(C(O)CN(CCCc2ccccc2)CCc2ccccc2)cc1Cl.
What is the InChIKey of 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol?
The InChIKey is XFUDQSBKBXSWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28Cl2N2O/c26-22-16-21(17-23(27)25(22)28)24(30)18-29(15-13-20-10-5-2-6-11-20)14-7-12-19-8-3-1-4-9-19/h1-6,8-11,16-17,24,30H,7,12-15,18,28H2.
What are the key properties of 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol?
1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol has a molecular weight of 443.42 g/mol, XLogP of 5.79, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-3,5-dichlorophenyl)-2-[2-phenylethyl(3-phenylpropyl)amino]ethanol is sourced from PubChem (CID 158613502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).