C11H4O6 — CID 15861434
8-methylfuro[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 15861434) has the molecular formula C11H4O6 and a molecular weight of 232.15 g/mol. Its IUPAC name is 8-methylfuro[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 8-methylfuro[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 15861434 |
| Molecular Formula | C11H4O6 |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 8-methylfuro[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | Cc1c2c(=O)oc(=O)c2cc2c(=O)oc(=O)c12 |
| InChI | InChI=1S/C11H4O6/c1-3-6-4(8(12)16-10(6)14)2-5-7(3)11(15)17-9(5)13/h2H,1H3 |
| InChIKey | VNJSMTXECMSPRW-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |