C32H44N2O8 — CID 158615302
(2S)-2-[2-[6-[2-[(3R,5S)-5-methoxycarbonyl-1-methylpyrrolidin-3-yl]oxycarbonyl-1,3-dihydroisoindol-4-yl]-2,2-dimethylhex-5-ynoxy]-2-oxoethyl]-3,3-dimethylbutanoic acid (PubChem CID 158615302) has the molecular formula C32H44N2O8 and a molecular weight of 584.71 g/mol. Its IUPAC name is (2S)-2-[2-[6-[2-[(3R,5S)-5-methoxycarbonyl-1-methylpyrrolidin-3-yl]oxycarbonyl-1,3-dihydroisoindol-4-yl]-2,2-dimethylhex-5-ynoxy]-2-oxoethyl]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[2-[6-[2-[(3R,5S)-5-methoxycarbonyl-1-methylpyrrolidin-3-yl]oxycarbonyl-1,3-dihydroisoindol-4-yl]-2,2-dimethylhex-5-ynoxy]-2-oxoethyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 158615302 |
| Molecular Formula | C32H44N2O8 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | (2S)-2-[2-[6-[2-[(3R,5S)-5-methoxycarbonyl-1-methylpyrrolidin-3-yl]oxycarbonyl-1,3-dihydroisoindol-4-yl]-2,2-dimethylhex-5-ynoxy]-2-oxoethyl]-3,3-dimethylbutanoic acid |
| SMILES | COC(=O)[C@@H]1C[C@@H](OC(=O)N2Cc3cccc(C#CCCC(C)(C)COC(=O)C[C@H](C(=O)O)C(C)(C)C)c3C2)CN1C |
| InChI | InChI=1S/C32H44N2O8/c1-31(2,3)25(28(36)37)16-27(35)41-20-32(4,5)14-9-8-11-21-12-10-13-22-17-34(19-24(21)22)30(39)42-23-15-26(29(38)40-7)33(6)18-23/h10,12-13,23,25-26H,9,14-20H2,1-7H3,(H,36,37)/t23-,25-,26+/m1/s1 |
| InChIKey | NGGPXIYNPJJFEF-ARMFNRFLSA-N |
| XLogP | 4.22 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|