C31H37N3O5S — CID 158615379
(4R,8S)-11-hydroxy-8-[2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetyl]-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 158615379) has the molecular formula C31H37N3O5S and a molecular weight of 563.72 g/mol. Its IUPAC name is (4R,8S)-11-hydroxy-8-[2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetyl]-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (4R,8S)-11-hydroxy-8-[2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetyl]-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 158615379 |
| Molecular Formula | C31H37N3O5S |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | (4R,8S)-11-hydroxy-8-[2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)acetyl]-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CCCC1O[C@@H]2CC3C4CCC5=CC(=O)C=CC5(C)C4C(O)CC3(C)[C@]2(C(=O)CSc2nc3ncccc3[nH]2)O1 |
| InChI | InChI=1S/C31H37N3O5S/c1-4-6-25-38-24-14-20-19-9-8-17-13-18(35)10-11-29(17,2)26(19)22(36)15-30(20,3)31(24,39-25)23(37)16-40-28-33-21-7-5-12-32-27(21)34-28/h5,7,10-13,19-20,22,24-26,36H,4,6,8-9,14-16H2,1-3H3,(H,32,33,34)/t19?,20?,22?,24-,25?,26?,29?,30?,31-/m1/s1 |
| InChIKey | IZOMJQKYXPHTGI-MHPZCZRCSA-N |
| XLogP | 4.79 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |