C18H36F2O3 — CID 158616195
2-(2,3-difluoro-4-methylcyclohexyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;trihydrate (PubChem CID 158616195) has the molecular formula C18H36F2O3 and a molecular weight of 338.48 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-methylcyclohexyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;trihydrate.
| Compound Name | 2-(2,3-difluoro-4-methylcyclohexyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;trihydrate |
|---|---|
| PubChem CID | 158616195 |
| Molecular Formula | C18H36F2O3 |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 2-(2,3-difluoro-4-methylcyclohexyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;trihydrate |
| SMILES | CC1CCC2CC(C3CCC(C)C(F)C3F)CCC2C1.O.O.O |
| InChI | InChI=1S/C18H30F2.3H2O/c1-11-3-5-14-10-15(7-6-13(14)9-11)16-8-4-12(2)17(19)18(16)20;;;/h11-18H,3-10H2,1-2H3;3*1H2 |
| InChIKey | KBKLFFHQFGZDAQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |