C24H20N4O2 — CID 158616602
5-[4-(5-cyclopropyl-1H-pyrrol-3-yl)phenyl]-1-(3H-indol-6-yl)imidazolidine-2,4-dione (PubChem CID 158616602) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 5-[4-(5-cyclopropyl-1H-pyrrol-3-yl)phenyl]-1-(3H-indol-6-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[4-(5-cyclopropyl-1H-pyrrol-3-yl)phenyl]-1-(3H-indol-6-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 158616602 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 5-[4-(5-cyclopropyl-1H-pyrrol-3-yl)phenyl]-1-(3H-indol-6-yl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)N(c2ccc3c(c2)N=CC3)C1c1ccc(-c2c[nH]c(C3CC3)c2)cc1 |
| InChI | InChI=1S/C24H20N4O2/c29-23-22(28(24(30)27-23)19-8-7-16-9-10-25-21(16)12-19)17-5-1-14(2-6-17)18-11-20(26-13-18)15-3-4-15/h1-2,5-8,10-13,15,22,26H,3-4,9H2,(H,27,29,30) |
| InChIKey | IJRGNMXDYBZIJT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|