About 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline
4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline (PubChem CID 158616667) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline.
Molecular Properties
| Compound Name | 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline |
| PubChem CID | 158616667 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline |
| SMILES | COC1CC(c2ccccc2)=Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H14N2O3/c1-21-16-10-15(11-5-3-2-4-6-11)17-14-8-7-12(18(19)20)9-13(14)16/h2-9,16H,10H2,1H3 |
| InChIKey | HXMASHLMBCPSSS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline?
The IUPAC name of 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline (CID 158616667) is 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline.
What is the SMILES notation for 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline?
The canonical SMILES for 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline is COC1CC(c2ccccc2)=Nc2ccc([N+](=O)[O-])cc21.
What is the InChIKey of 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline?
The InChIKey is HXMASHLMBCPSSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c1-21-16-10-15(11-5-3-2-4-6-11)17-14-8-7-12(18(19)20)9-13(14)16/h2-9,16H,10H2,1H3.
What are the key properties of 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline?
4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline has a molecular weight of 282.30 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-nitro-2-phenyl-3,4-dihydroquinoline is sourced from PubChem (CID 158616667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).