About acetylene;1H-pyrimidine-2,4-dione
acetylene;1H-pyrimidine-2,4-dione (PubChem CID 158617730) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is acetylene;1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | acetylene;1H-pyrimidine-2,4-dione |
| PubChem CID | 158617730 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | acetylene;1H-pyrimidine-2,4-dione |
| SMILES | C#C.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O2.C2H2/c7-3-1-2-5-4(8)6-3;1-2/h1-2H,(H2,5,6,7,8);1-2H |
| InChIKey | HXPFQVDXPWYRBJ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1H-pyrimidine-2,4-dione?
The IUPAC name of acetylene;1H-pyrimidine-2,4-dione (CID 158617730) is acetylene;1H-pyrimidine-2,4-dione.
What is the SMILES notation for acetylene;1H-pyrimidine-2,4-dione?
The canonical SMILES for acetylene;1H-pyrimidine-2,4-dione is C#C.O=c1cc[nH]c(=O)[nH]1.
What is the InChIKey of acetylene;1H-pyrimidine-2,4-dione?
The InChIKey is HXPFQVDXPWYRBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.C2H2/c7-3-1-2-5-4(8)6-3;1-2/h1-2H,(H2,5,6,7,8);1-2H.
What are the key properties of acetylene;1H-pyrimidine-2,4-dione?
acetylene;1H-pyrimidine-2,4-dione has a molecular weight of 138.13 g/mol, XLogP of -0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1H-pyrimidine-2,4-dione is sourced from PubChem (CID 158617730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).